Organic acids and derivatives
Filtered Search Results
Ethyl 2-methylbutyrate, 99%
CAS: 7452-79-1 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.19 MDL Number: MFCD00012217 InChI Key: HCRBXQFHJMCTLF-UHFFFAOYSA-N Synonym: ethyl 2-methylbutyrate,butanoic acid, 2-methyl-, ethyl ester,butyric acid, 2-methyl-, ethyl ester,ethyl 2-methyl butyrate,ethyl alpha-methylbutyrate,dl-2-methylbutyric acid ethyl ester,ethyl 2-methyl-butanoate,ethyl .alpha.-methylbutyrate,2-methylbutanoic acid ethyl ester,butyric acid, 2-methyl-, ethyl ester 8ci PubChem CID: 24020 IUPAC Name: ethyl 2-methylbutanoate SMILES: CCC(C)C(=O)OCC
| PubChem CID | 24020 |
|---|---|
| CAS | 7452-79-1 |
| Molecular Weight (g/mol) | 130.19 |
| MDL Number | MFCD00012217 |
| SMILES | CCC(C)C(=O)OCC |
| Synonym | ethyl 2-methylbutyrate,butanoic acid, 2-methyl-, ethyl ester,butyric acid, 2-methyl-, ethyl ester,ethyl 2-methyl butyrate,ethyl alpha-methylbutyrate,dl-2-methylbutyric acid ethyl ester,ethyl 2-methyl-butanoate,ethyl .alpha.-methylbutyrate,2-methylbutanoic acid ethyl ester,butyric acid, 2-methyl-, ethyl ester 8ci |
| IUPAC Name | ethyl 2-methylbutanoate |
| InChI Key | HCRBXQFHJMCTLF-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
Indole-2-carboxylic acid, 99%
CAS: 1477-50-5 Molecular Formula: C9H7NO2 Molecular Weight (g/mol): 161.16 MDL Number: MFCD00005611 InChI Key: HCUARRIEZVDMPT-UHFFFAOYSA-N Synonym: indole-2-carboxylic acid,2-carboxyindole,2-indolecarboxylic acid,indol-2-carboxylic acid,1h-indolecarboxylic acid,indole-2-carboxylate,2-indolylformic acid,2-indole carboxylic acid,1h-indol-2-carbons,carboxyindole PubChem CID: 72899 IUPAC Name: 1H-indole-2-carboxylic acid SMILES: OC(=O)C1=CC2=CC=CC=C2N1
| PubChem CID | 72899 |
|---|---|
| CAS | 1477-50-5 |
| Molecular Weight (g/mol) | 161.16 |
| MDL Number | MFCD00005611 |
| SMILES | OC(=O)C1=CC2=CC=CC=C2N1 |
| Synonym | indole-2-carboxylic acid,2-carboxyindole,2-indolecarboxylic acid,indol-2-carboxylic acid,1h-indolecarboxylic acid,indole-2-carboxylate,2-indolylformic acid,2-indole carboxylic acid,1h-indol-2-carbons,carboxyindole |
| IUPAC Name | 1H-indole-2-carboxylic acid |
| InChI Key | HCUARRIEZVDMPT-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO2 |
1-Naphthylacetic acid, 95%, may cont. up to 5% 2-isomer
CAS: 86-87-3 Molecular Formula: C12H10O2 Molecular Weight (g/mol): 186.21 MDL Number: MFCD00004046 InChI Key: PRPINYUDVPFIRX-UHFFFAOYSA-N Synonym: 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop PubChem CID: 6862 ChEBI: CHEBI:32918 IUPAC Name: 2-naphthalen-1-ylacetic acid SMILES: OC(=O)CC1=C2C=CC=CC2=CC=C1
| PubChem CID | 6862 |
|---|---|
| CAS | 86-87-3 |
| Molecular Weight (g/mol) | 186.21 |
| ChEBI | CHEBI:32918 |
| MDL Number | MFCD00004046 |
| SMILES | OC(=O)CC1=C2C=CC=CC2=CC=C1 |
| Synonym | 1-naphthylacetic acid,1-naphthaleneacetic acid,2-naphthalen-1-yl acetic acid,naphthalene-1-acetic acid,transplantone,phyomone,planofix,1-naphthalene acetic acid,fruitone n,stop-drop |
| IUPAC Name | 2-naphthalen-1-ylacetic acid |
| InChI Key | PRPINYUDVPFIRX-UHFFFAOYSA-N |
| Molecular Formula | C12H10O2 |
Benzyl L-lactate, 97%
CAS: 56777-24-3 Molecular Formula: C10H12O3 Molecular Weight (g/mol): 180.203 MDL Number: MFCD00209546 InChI Key: ZYTLPUIDJRKAAM-QMMMGPOBSA-N Synonym: benzyl s---lactate,benzyl l-lactate,benzyl s-lactate,s---lactic acid benzyl ester,benzyl 2s-2-hydroxypropanoate,benzyl-l-lactate,s-benzyllactate,s-benzyl lactate,s-lactic acid benzyl ester,2s-lactic acid benzyl ester PubChem CID: 11052238 IUPAC Name: benzyl (2S)-2-hydroxypropanoate SMILES: CC(C(=O)OCC1=CC=CC=C1)O
| PubChem CID | 11052238 |
|---|---|
| CAS | 56777-24-3 |
| Molecular Weight (g/mol) | 180.203 |
| MDL Number | MFCD00209546 |
| SMILES | CC(C(=O)OCC1=CC=CC=C1)O |
| Synonym | benzyl s---lactate,benzyl l-lactate,benzyl s-lactate,s---lactic acid benzyl ester,benzyl 2s-2-hydroxypropanoate,benzyl-l-lactate,s-benzyllactate,s-benzyl lactate,s-lactic acid benzyl ester,2s-lactic acid benzyl ester |
| IUPAC Name | benzyl (2S)-2-hydroxypropanoate |
| InChI Key | ZYTLPUIDJRKAAM-QMMMGPOBSA-N |
| Molecular Formula | C10H12O3 |
n-Butyl lactate, 99%
CAS: 138-22-7 Molecular Formula: C7H14O3 Molecular Weight (g/mol): 146.19 MDL Number: MFCD00004519 InChI Key: MRABAEUHTLLEML-UHFFFAOYNA-N Synonym: butyl lactate,n-butyl lactate,lactic acid, butyl ester,propanoic acid, 2-hydroxy-, butyl ester,butyllactate,2-hydroxypropanoic acid butyl ester,butylester kyseliny mlecne,butyl alpha-hydroxypropionate,butyl lactate natural,fema no. 2205 PubChem CID: 8738 IUPAC Name: butyl 2-hydroxypropanoate SMILES: CCCCOC(=O)C(C)O
| PubChem CID | 8738 |
|---|---|
| CAS | 138-22-7 |
| Molecular Weight (g/mol) | 146.19 |
| MDL Number | MFCD00004519 |
| SMILES | CCCCOC(=O)C(C)O |
| Synonym | butyl lactate,n-butyl lactate,lactic acid, butyl ester,propanoic acid, 2-hydroxy-, butyl ester,butyllactate,2-hydroxypropanoic acid butyl ester,butylester kyseliny mlecne,butyl alpha-hydroxypropionate,butyl lactate natural,fema no. 2205 |
| IUPAC Name | butyl 2-hydroxypropanoate |
| InChI Key | MRABAEUHTLLEML-UHFFFAOYNA-N |
| Molecular Formula | C7H14O3 |
Ethyl mercaptoacetate, 98+%
CAS: 623-51-8 Molecular Formula: C4H8O2S Molecular Weight (g/mol): 120.166 MDL Number: MFCD00004874 InChI Key: PVBRSNZAOAJRKO-UHFFFAOYSA-N Synonym: ethyl thioglycolate,ethyl mercaptoacetate,ethyl 2-mercaptoacetate,mercaptoacetic acid ethyl ester,ethyl thioglycollate,acetic acid, mercapto-, ethyl ester,thioglycolic acid ethyl ester,ethyl mercaptoacetic acid,usaf ek-2070,acetic acid, 2-mercapto-, ethyl ester PubChem CID: 12185 IUPAC Name: ethyl 2-sulfanylacetate SMILES: CCOC(=O)CS
| PubChem CID | 12185 |
|---|---|
| CAS | 623-51-8 |
| Molecular Weight (g/mol) | 120.166 |
| MDL Number | MFCD00004874 |
| SMILES | CCOC(=O)CS |
| Synonym | ethyl thioglycolate,ethyl mercaptoacetate,ethyl 2-mercaptoacetate,mercaptoacetic acid ethyl ester,ethyl thioglycollate,acetic acid, mercapto-, ethyl ester,thioglycolic acid ethyl ester,ethyl mercaptoacetic acid,usaf ek-2070,acetic acid, 2-mercapto-, ethyl ester |
| IUPAC Name | ethyl 2-sulfanylacetate |
| InChI Key | PVBRSNZAOAJRKO-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2S |
4-Cyanophenylacetic acid, 97%
CAS: 5462-71-5 Molecular Formula: C9H7NO2 Molecular Weight (g/mol): 161.16 MDL Number: MFCD06798066 InChI Key: WEBXRQONNWEETE-UHFFFAOYSA-N Synonym: 2-4-cyanophenyl acetic acid,4-cyanophenylacetic acid,4-cyanophenyl acetic acid,benzeneacetic acid, 4-cyano,4-cyano-phenyl-acetic acid,p-cyanophenylacetic acid,4-cyanobenzeneacetic acid,p-cyanophenyl acetic acid,acetic acid, p-cyanophenyl PubChem CID: 79587 IUPAC Name: 2-(4-cyanophenyl)acetic acid SMILES: OC(=O)CC1=CC=C(C=C1)C#N
| PubChem CID | 79587 |
|---|---|
| CAS | 5462-71-5 |
| Molecular Weight (g/mol) | 161.16 |
| MDL Number | MFCD06798066 |
| SMILES | OC(=O)CC1=CC=C(C=C1)C#N |
| Synonym | 2-4-cyanophenyl acetic acid,4-cyanophenylacetic acid,4-cyanophenyl acetic acid,benzeneacetic acid, 4-cyano,4-cyano-phenyl-acetic acid,p-cyanophenylacetic acid,4-cyanobenzeneacetic acid,p-cyanophenyl acetic acid,acetic acid, p-cyanophenyl |
| IUPAC Name | 2-(4-cyanophenyl)acetic acid |
| InChI Key | WEBXRQONNWEETE-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO2 |
1-Phenylcyclohexanecarboxylic acid, 99%
CAS: 1135-67-7 Molecular Formula: C13H16O2 Molecular Weight (g/mol): 204.269 MDL Number: MFCD00037152 InChI Key: QXXHHHWXFHPNOS-UHFFFAOYSA-N Synonym: 1-phenylcyclohexanecarboxylic acid,1-phenyl-1-cyclohexanecarboxylic acid,1-phenyl-cyclohexanecarboxylic acid,cyclohexanecarboxylic acid, 1-phenyl,acmc-1c6ij,1-phenylcyclohexanecarboxylicacid,qxxhhhwxfhpnos-uhfffaoysa,1-phenylcyclohexanecarboxylic acid #,cyclohexanecarboxylicacid, 1-phenyl,1-phenyl-1-cyclohexane carboxylic acid PubChem CID: 70817 IUPAC Name: 1-phenylcyclohexane-1-carboxylic acid SMILES: C1CCC(CC1)(C2=CC=CC=C2)C(=O)O
| PubChem CID | 70817 |
|---|---|
| CAS | 1135-67-7 |
| Molecular Weight (g/mol) | 204.269 |
| MDL Number | MFCD00037152 |
| SMILES | C1CCC(CC1)(C2=CC=CC=C2)C(=O)O |
| Synonym | 1-phenylcyclohexanecarboxylic acid,1-phenyl-1-cyclohexanecarboxylic acid,1-phenyl-cyclohexanecarboxylic acid,cyclohexanecarboxylic acid, 1-phenyl,acmc-1c6ij,1-phenylcyclohexanecarboxylicacid,qxxhhhwxfhpnos-uhfffaoysa,1-phenylcyclohexanecarboxylic acid #,cyclohexanecarboxylicacid, 1-phenyl,1-phenyl-1-cyclohexane carboxylic acid |
| IUPAC Name | 1-phenylcyclohexane-1-carboxylic acid |
| InChI Key | QXXHHHWXFHPNOS-UHFFFAOYSA-N |
| Molecular Formula | C13H16O2 |
Propyl Gallate, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
(S)-(+)-2-Methylbutyric acid, 98%
CAS: 1730-91-2 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00063166 InChI Key: WLAMNBDJUVNPJU-BYPYZUCNSA-N Synonym: s-+-2-methylbutyric acid,s-2-methylbutanoic acid,s-2-methylbutyric acid,2s-2-methylbutanoic acid,2-methylbutyric acid, s,s-+-2-methylbutanoic acid,smb,s-2-methylbutanoate,butanoic acid, 2-methyl-, s,+-2-methylbutanoic acid PubChem CID: 448893 ChEBI: CHEBI:38655 IUPAC Name: (2S)-2-methylbutanoic acid SMILES: CCC(C)C(=O)O
| PubChem CID | 448893 |
|---|---|
| CAS | 1730-91-2 |
| Molecular Weight (g/mol) | 102.13 |
| ChEBI | CHEBI:38655 |
| MDL Number | MFCD00063166 |
| SMILES | CCC(C)C(=O)O |
| Synonym | s-+-2-methylbutyric acid,s-2-methylbutanoic acid,s-2-methylbutyric acid,2s-2-methylbutanoic acid,2-methylbutyric acid, s,s-+-2-methylbutanoic acid,smb,s-2-methylbutanoate,butanoic acid, 2-methyl-, s,+-2-methylbutanoic acid |
| IUPAC Name | (2S)-2-methylbutanoic acid |
| InChI Key | WLAMNBDJUVNPJU-BYPYZUCNSA-N |
| Molecular Formula | C5H10O2 |
1-Naphthyl butyrate, 98%
CAS: 3121-70-8 Molecular Formula: C14H14O2 Molecular Weight (g/mol): 214.26 MDL Number: MFCD00003923 InChI Key: XIVJNRXPRQKFRZ-UHFFFAOYSA-N Synonym: 1-naphthyl butyrate,.alpha.-naphthyl butyrate,alpha-naphthyl butyrate,naphthalen-1-yl butyrate,butanoic acid, 1-naphthalenyl ester,butyric acid, 1-naphthyl ester,1-naphthylbutyrate,unii-9uzl9u0cik,butyric acid 1-naphthyl ester,9uzl9u0cik PubChem CID: 76571 IUPAC Name: naphthalen-1-yl butanoate SMILES: CCCC(=O)OC1=CC=CC2=CC=CC=C21
| PubChem CID | 76571 |
|---|---|
| CAS | 3121-70-8 |
| Molecular Weight (g/mol) | 214.26 |
| MDL Number | MFCD00003923 |
| SMILES | CCCC(=O)OC1=CC=CC2=CC=CC=C21 |
| Synonym | 1-naphthyl butyrate,.alpha.-naphthyl butyrate,alpha-naphthyl butyrate,naphthalen-1-yl butyrate,butanoic acid, 1-naphthalenyl ester,butyric acid, 1-naphthyl ester,1-naphthylbutyrate,unii-9uzl9u0cik,butyric acid 1-naphthyl ester,9uzl9u0cik |
| IUPAC Name | naphthalen-1-yl butanoate |
| InChI Key | XIVJNRXPRQKFRZ-UHFFFAOYSA-N |
| Molecular Formula | C14H14O2 |
Ethyl levulinate, 98%
CAS: 539-88-8 Molecular Formula: C7H12O3 Molecular Weight (g/mol): 144.17 MDL Number: MFCD00009209 InChI Key: GMEONFUTDYJSNV-UHFFFAOYSA-N Synonym: ethyl levulinate,ethyl levulate,ethyl laevulinate,levulinic acid, ethyl ester,ethyl 4-ketovalerate,ethyl 3-acetylpropionate,ethyl 4-oxovalerate,pentanoic acid, 4-oxo-, ethyl ester,ethyl ketovalerate,ethyl acetylpropanoate PubChem CID: 10883 IUPAC Name: ethyl 4-oxopentanoate SMILES: CCOC(=O)CCC(C)=O
| PubChem CID | 10883 |
|---|---|
| CAS | 539-88-8 |
| Molecular Weight (g/mol) | 144.17 |
| MDL Number | MFCD00009209 |
| SMILES | CCOC(=O)CCC(C)=O |
| Synonym | ethyl levulinate,ethyl levulate,ethyl laevulinate,levulinic acid, ethyl ester,ethyl 4-ketovalerate,ethyl 3-acetylpropionate,ethyl 4-oxovalerate,pentanoic acid, 4-oxo-, ethyl ester,ethyl ketovalerate,ethyl acetylpropanoate |
| IUPAC Name | ethyl 4-oxopentanoate |
| InChI Key | GMEONFUTDYJSNV-UHFFFAOYSA-N |
| Molecular Formula | C7H12O3 |
4-Cyanophenylacetic acid, 97%
CAS: 5462-71-5 Molecular Formula: C9H7NO2 Molecular Weight (g/mol): 161.16 MDL Number: MFCD06798066 InChI Key: WEBXRQONNWEETE-UHFFFAOYSA-N Synonym: 2-4-cyanophenyl acetic acid,4-cyanophenylacetic acid,4-cyanophenyl acetic acid,benzeneacetic acid, 4-cyano,4-cyano-phenyl-acetic acid,p-cyanophenylacetic acid,4-cyanobenzeneacetic acid,p-cyanophenyl acetic acid,acetic acid, p-cyanophenyl PubChem CID: 79587 IUPAC Name: 2-(4-cyanophenyl)acetic acid SMILES: OC(=O)CC1=CC=C(C=C1)C#N
| PubChem CID | 79587 |
|---|---|
| CAS | 5462-71-5 |
| Molecular Weight (g/mol) | 161.16 |
| MDL Number | MFCD06798066 |
| SMILES | OC(=O)CC1=CC=C(C=C1)C#N |
| Synonym | 2-4-cyanophenyl acetic acid,4-cyanophenylacetic acid,4-cyanophenyl acetic acid,benzeneacetic acid, 4-cyano,4-cyano-phenyl-acetic acid,p-cyanophenylacetic acid,4-cyanobenzeneacetic acid,p-cyanophenyl acetic acid,acetic acid, p-cyanophenyl |
| IUPAC Name | 2-(4-cyanophenyl)acetic acid |
| InChI Key | WEBXRQONNWEETE-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO2 |
3-(3-Bromophenyl)propionic acid, 97%
CAS: 42287-90-1 Molecular Formula: C9H9BrO2 Molecular Weight (g/mol): 229.073 MDL Number: MFCD01310792 InChI Key: DWKWMFSWLCIMKI-UHFFFAOYSA-N Synonym: 3-3-bromophenyl propanoic acid,3-3-bromophenyl propionic acid,3-3-bromo-phenyl-propionic acid,3-bromophenylpropanoic acid,acmc-209jor,m-bromohydrocinnamic acid,3-bromohydrocinnamic acid,benzenepropanoic acid,3-bromo,3-3-bromophenyl propionicacid,3-m-bromophenyl propionic acid PubChem CID: 2063862 IUPAC Name: 3-(3-bromophenyl)propanoic acid SMILES: C1=CC(=CC(=C1)Br)CCC(=O)O
| PubChem CID | 2063862 |
|---|---|
| CAS | 42287-90-1 |
| Molecular Weight (g/mol) | 229.073 |
| MDL Number | MFCD01310792 |
| SMILES | C1=CC(=CC(=C1)Br)CCC(=O)O |
| Synonym | 3-3-bromophenyl propanoic acid,3-3-bromophenyl propionic acid,3-3-bromo-phenyl-propionic acid,3-bromophenylpropanoic acid,acmc-209jor,m-bromohydrocinnamic acid,3-bromohydrocinnamic acid,benzenepropanoic acid,3-bromo,3-3-bromophenyl propionicacid,3-m-bromophenyl propionic acid |
| IUPAC Name | 3-(3-bromophenyl)propanoic acid |
| InChI Key | DWKWMFSWLCIMKI-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO2 |